C21H41N3O3 — CID 109390712
1-(3-ethoxy-2,2-diethylcyclobutyl)-3-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]guanidine (PubChem CID 109390712) has the molecular formula C21H41N3O3 and a molecular weight of 383.58 g/mol. Its IUPAC name is 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]guanidine.
| Compound Name | 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 109390712 |
| Molecular Formula | C21H41N3O3 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.31 |
| IUPAC Name | 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCOCC1CCOC1)NC1CC(OCC)C1(CC)CC |
| InChI | InChI=1S/C21H41N3O3/c1-5-21(6-2)18(14-19(21)27-8-4)24-20(22-7-3)23-11-9-12-25-15-17-10-13-26-16-17/h17-19H,5-16H2,1-4H3,(H2,22,23,24) |
| InChIKey | APARITMMFDJKSS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|