C20H39IN4O3 — CID 109390659
2-[[[(3-ethoxy-2,2-diethylcyclobutyl)amino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 109390659) has the molecular formula C20H39IN4O3 and a molecular weight of 510.46 g/mol. Its IUPAC name is 2-[[[(3-ethoxy-2,2-diethylcyclobutyl)amino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(3-ethoxy-2,2-diethylcyclobutyl)amino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 109390659 |
| Molecular Formula | C20H39IN4O3 |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 2-[[[(3-ethoxy-2,2-diethylcyclobutyl)amino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCOC1CC(N/C(=N/CC(=O)N(C)C)NCC2CCOC2)C1(CC)CC.I |
| InChI | InChI=1S/C20H38N4O3.HI/c1-6-20(7-2)16(11-17(20)27-8-3)23-19(22-13-18(25)24(4)5)21-12-15-9-10-26-14-15;/h15-17H,6-14H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | POPAXJHGEASZFV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|