C22H43N5O3 — CID 109390352
2-[[[(3-ethoxy-2,2-diethylcyclobutyl)amino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 109390352) has the molecular formula C22H43N5O3 and a molecular weight of 425.62 g/mol. Its IUPAC name is 2-[[[(3-ethoxy-2,2-diethylcyclobutyl)amino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[(3-ethoxy-2,2-diethylcyclobutyl)amino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 109390352 |
| Molecular Formula | C22H43N5O3 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.34 |
| IUPAC Name | 2-[[[(3-ethoxy-2,2-diethylcyclobutyl)amino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCOC1CC(N/C(=N/CC(=O)N(C)C)NCCCN2CCOCC2)C1(CC)CC |
| InChI | InChI=1S/C22H43N5O3/c1-6-22(7-2)18(16-19(22)30-8-3)25-21(24-17-20(28)26(4)5)23-10-9-11-27-12-14-29-15-13-27/h18-19H,6-17H2,1-5H3,(H2,23,24,25) |
| InChIKey | JMXLGAWCFBVABY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|