C22H43N5O3 — CID 110049840
N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[(2-pentan-3-yloxan-4-yl)amino]methylidene]amino]acetamide (PubChem CID 110049840) has the molecular formula C22H43N5O3 and a molecular weight of 425.62 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[(2-pentan-3-yloxan-4-yl)amino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[(2-pentan-3-yloxan-4-yl)amino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110049840 |
| Molecular Formula | C22H43N5O3 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.34 |
| IUPAC Name | N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[(2-pentan-3-yloxan-4-yl)amino]methylidene]amino]acetamide |
| SMILES | CCC(CC)C1CC(N/C(=N/CC(=O)N(C)C)NCCCN2CCOCC2)CCO1 |
| InChI | InChI=1S/C22H43N5O3/c1-5-18(6-2)20-16-19(8-13-30-20)25-22(24-17-21(28)26(3)4)23-9-7-10-27-11-14-29-15-12-27/h18-20H,5-17H2,1-4H3,(H2,23,24,25) |
| InChIKey | PROOPZJQVYGNKD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|