C21H36N6O2S — CID 110045631
N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[(1-thiophen-2-ylpiperidin-4-yl)amino]methylidene]amino]acetamide (PubChem CID 110045631) has the molecular formula C21H36N6O2S and a molecular weight of 436.63 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[(1-thiophen-2-ylpiperidin-4-yl)amino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[(1-thiophen-2-ylpiperidin-4-yl)amino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110045631 |
| Molecular Formula | C21H36N6O2S |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[(1-thiophen-2-ylpiperidin-4-yl)amino]methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCCN1CCOCC1)NC1CCN(c2cccs2)CC1 |
| InChI | InChI=1S/C21H36N6O2S/c1-25(2)19(28)17-23-21(22-8-4-9-26-12-14-29-15-13-26)24-18-6-10-27(11-7-18)20-5-3-16-30-20/h3,5,16,18H,4,6-15,17H2,1-2H3,(H2,22,23,24) |
| InChIKey | DHISMODWDKUISS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|