C21H33F2IN6O2 — CID 110045280
2-[[[[1-(2,6-difluorophenyl)pyrrolidin-3-yl]amino]-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110045280) has the molecular formula C21H33F2IN6O2 and a molecular weight of 566.44 g/mol. Its IUPAC name is 2-[[[[1-(2,6-difluorophenyl)pyrrolidin-3-yl]amino]-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[[1-(2,6-difluorophenyl)pyrrolidin-3-yl]amino]-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110045280 |
| Molecular Formula | C21H33F2IN6O2 |
| Molecular Weight | 566.44 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | 2-[[[[1-(2,6-difluorophenyl)pyrrolidin-3-yl]amino]-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCN1CCOCC1)NC1CCN(c2c(F)cccc2F)C1.I |
| InChI | InChI=1S/C21H32F2N6O2.HI/c1-27(2)19(30)14-25-21(24-7-9-28-10-12-31-13-11-28)26-16-6-8-29(15-16)20-17(22)4-3-5-18(20)23;/h3-5,16H,6-15H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | UJNWBAULXYMKLM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|