C19H28F2IN5O — CID 110045282
2-[[[[1-(2,6-difluorophenyl)pyrrolidin-3-yl]amino]-(2-methylprop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110045282) has the molecular formula C19H28F2IN5O and a molecular weight of 507.37 g/mol. Its IUPAC name is 2-[[[[1-(2,6-difluorophenyl)pyrrolidin-3-yl]amino]-(2-methylprop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[[1-(2,6-difluorophenyl)pyrrolidin-3-yl]amino]-(2-methylprop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110045282 |
| Molecular Formula | C19H28F2IN5O |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 2-[[[[1-(2,6-difluorophenyl)pyrrolidin-3-yl]amino]-(2-methylprop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | C=C(C)CN/C(=N\CC(=O)N(C)C)NC1CCN(c2c(F)cccc2F)C1.I |
| InChI | InChI=1S/C19H27F2N5O.HI/c1-13(2)10-22-19(23-11-17(27)25(3)4)24-14-8-9-26(12-14)18-15(20)6-5-7-16(18)21;/h5-7,14H,1,8-12H2,2-4H3,(H2,22,23,24);1H |
| InChIKey | YKTWRHCAENDXQR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|