C20H29F2N5O2 — CID 110045309
2-[[[[1-(2,6-difluorophenyl)pyrrolidin-3-yl]amino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110045309) has the molecular formula C20H29F2N5O2 and a molecular weight of 409.48 g/mol. Its IUPAC name is 2-[[[[1-(2,6-difluorophenyl)pyrrolidin-3-yl]amino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[1-(2,6-difluorophenyl)pyrrolidin-3-yl]amino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110045309 |
| Molecular Formula | C20H29F2N5O2 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 2-[[[[1-(2,6-difluorophenyl)pyrrolidin-3-yl]amino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCOC1)NC1CCN(c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C20H29F2N5O2/c1-26(2)18(28)11-24-20(23-10-14-7-9-29-13-14)25-15-6-8-27(12-15)19-16(21)4-3-5-17(19)22/h3-5,14-15H,6-13H2,1-2H3,(H2,23,24,25) |
| InChIKey | DDGUCGUOHGHWGN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|