C19H29FN6O2 — CID 110045503
2-[[[[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]amino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110045503) has the molecular formula C19H29FN6O2 and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-[[[[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]amino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]amino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110045503 |
| Molecular Formula | C19H29FN6O2 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-[[[[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]amino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCOC1)NC1CCN(c2ncccc2F)C1 |
| InChI | InChI=1S/C19H29FN6O2/c1-25(2)17(27)11-23-19(22-10-14-6-9-28-13-14)24-15-5-8-26(12-15)18-16(20)4-3-7-21-18/h3-4,7,14-15H,5-6,8-13H2,1-2H3,(H2,22,23,24) |
| InChIKey | OZNRSRQULHGUMP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|