C21H28FN5O2 — CID 110058662
1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[2-(furan-2-yl)ethyl]-2-(oxolan-3-ylmethyl)guanidine (PubChem CID 110058662) has the molecular formula C21H28FN5O2 and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[2-(furan-2-yl)ethyl]-2-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[2-(furan-2-yl)ethyl]-2-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110058662 |
| Molecular Formula | C21H28FN5O2 |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[2-(furan-2-yl)ethyl]-2-(oxolan-3-ylmethyl)guanidine |
| SMILES | Fc1cccnc1N1CCC(N/C(=N/CC2CCOC2)NCCc2ccco2)C1 |
| InChI | InChI=1S/C21H28FN5O2/c22-19-4-1-8-23-20(19)27-10-6-17(14-27)26-21(25-13-16-7-12-28-15-16)24-9-5-18-3-2-11-29-18/h1-4,8,11,16-17H,5-7,9-10,12-15H2,(H2,24,25,26) |
| InChIKey | BXWZJZQKUXJEOQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|