C21H29FIN5O2 — CID 110058659
1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110058659) has the molecular formula C21H29FIN5O2 and a molecular weight of 529.40 g/mol. Its IUPAC name is 1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110058659 |
| Molecular Formula | C21H29FIN5O2 |
| Molecular Weight | 529.40 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | Fc1cccnc1N1CCC(N/C(=N/CC2CCCO2)NCCc2ccco2)C1.I |
| InChI | InChI=1S/C21H28FN5O2.HI/c22-19-6-1-9-23-20(19)27-11-8-16(15-27)26-21(25-14-18-5-3-13-29-18)24-10-7-17-4-2-12-28-17;/h1-2,4,6,9,12,16,18H,3,5,7-8,10-11,13-15H2,(H2,24,25,26);1H |
| InChIKey | VVEYUCXDFXPMJC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|