C22H31N5O2 — CID 110054774
1-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)-3-(1-pyridin-2-ylpiperidin-4-yl)guanidine (PubChem CID 110054774) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)-3-(1-pyridin-2-ylpiperidin-4-yl)guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)-3-(1-pyridin-2-ylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 110054774 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)-3-(1-pyridin-2-ylpiperidin-4-yl)guanidine |
| SMILES | c1ccc(N2CCC(N/C(=N/CC3CCCO3)NCCc3ccco3)CC2)nc1 |
| InChI | InChI=1S/C22H31N5O2/c1-2-11-23-21(7-1)27-13-9-18(10-14-27)26-22(25-17-20-6-4-16-29-20)24-12-8-19-5-3-15-28-19/h1-3,5,7,11,15,18,20H,4,6,8-10,12-14,16-17H2,(H2,24,25,26) |
| InChIKey | OWNXNSGIIPZBFZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|