C17H28ClIN6O2 — CID 110046628
2-[[[[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110046628) has the molecular formula C17H28ClIN6O2 and a molecular weight of 510.81 g/mol. Its IUPAC name is 2-[[[[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110046628 |
| Molecular Formula | C17H28ClIN6O2 |
| Molecular Weight | 510.81 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 2-[[[[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COCCN/C(=N\CC(=O)N(C)C)NC1CCN(c2ncccc2Cl)C1.I |
| InChI | InChI=1S/C17H27ClN6O2.HI/c1-23(2)15(25)11-21-17(20-8-10-26-3)22-13-6-9-24(12-13)16-14(18)5-4-7-19-16;/h4-5,7,13H,6,8-12H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | DCTXOLHSLODXLY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.81 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|