C17H29N7O — CID 110039147
N,N-dimethyl-2-[[propylamino-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]methylidene]amino]acetamide (PubChem CID 110039147) has the molecular formula C17H29N7O and a molecular weight of 347.47 g/mol. Its IUPAC name is N,N-dimethyl-2-[[propylamino-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[propylamino-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110039147 |
| Molecular Formula | C17H29N7O |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | N,N-dimethyl-2-[[propylamino-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]methylidene]amino]acetamide |
| SMILES | CCCN/C(=N\CC(=O)N(C)C)NC1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H29N7O/c1-4-8-18-16(21-13-15(25)23(2)3)22-14-6-11-24(12-7-14)17-19-9-5-10-20-17/h5,9-10,14H,4,6-8,11-13H2,1-3H3,(H2,18,21,22) |
| InChIKey | ZTYJVYHQZJGDFE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|