C22H39N7O — CID 110039121
2-[[(2-ethylhexylamino)-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110039121) has the molecular formula C22H39N7O and a molecular weight of 417.60 g/mol. Its IUPAC name is 2-[[(2-ethylhexylamino)-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(2-ethylhexylamino)-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110039121 |
| Molecular Formula | C22H39N7O |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | 2-[[(2-ethylhexylamino)-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCCCC(CC)CN/C(=N\CC(=O)N(C)C)NC1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H39N7O/c1-5-7-9-18(6-2)16-25-21(26-17-20(30)28(3)4)27-19-10-14-29(15-11-19)22-23-12-8-13-24-22/h8,12-13,18-19H,5-7,9-11,14-17H2,1-4H3,(H2,25,26,27) |
| InChIKey | LFZFLWHCWFTEPJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|