C20H38IN7O — CID 110043310
2-[[(2-ethylhexylamino)-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110043310) has the molecular formula C20H38IN7O and a molecular weight of 519.48 g/mol. Its IUPAC name is 2-[[(2-ethylhexylamino)-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(2-ethylhexylamino)-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110043310 |
| Molecular Formula | C20H38IN7O |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 2-[[(2-ethylhexylamino)-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCCCC(CC)CN/C(=N\CC(=O)N(C)C)NC1CCCn2nc(C)nc21.I |
| InChI | InChI=1S/C20H37N7O.HI/c1-6-8-10-16(7-2)13-21-20(22-14-18(28)26(4)5)24-17-11-9-12-27-19(17)23-15(3)25-27;/h16-17H,6-14H2,1-5H3,(H2,21,22,24);1H |
| InChIKey | ZSTHMKOXHQCZGT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|