C22H43IN6O — CID 110044258
2-[[(2-ethylhexylamino)-[1-(1,3,5-trimethylpyrazol-4-yl)propan-2-ylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110044258) has the molecular formula C22H43IN6O and a molecular weight of 534.53 g/mol. Its IUPAC name is 2-[[(2-ethylhexylamino)-[1-(1,3,5-trimethylpyrazol-4-yl)propan-2-ylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(2-ethylhexylamino)-[1-(1,3,5-trimethylpyrazol-4-yl)propan-2-ylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110044258 |
| Molecular Formula | C22H43IN6O |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 2-[[(2-ethylhexylamino)-[1-(1,3,5-trimethylpyrazol-4-yl)propan-2-ylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCCCC(CC)CN/C(=N\CC(=O)N(C)C)NC(C)Cc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C22H42N6O.HI/c1-9-11-12-19(10-2)14-23-22(24-15-21(29)27(6)7)25-16(3)13-20-17(4)26-28(8)18(20)5;/h16,19H,9-15H2,1-8H3,(H2,23,24,25);1H |
| InChIKey | KPPNBQZLNLOCPK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|