C17H32N6O — CID 110044279
N,N-dimethyl-2-[[propylamino-[1-(1,3,5-trimethylpyrazol-4-yl)propan-2-ylamino]methylidene]amino]acetamide (PubChem CID 110044279) has the molecular formula C17H32N6O and a molecular weight of 336.48 g/mol. Its IUPAC name is N,N-dimethyl-2-[[propylamino-[1-(1,3,5-trimethylpyrazol-4-yl)propan-2-ylamino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[propylamino-[1-(1,3,5-trimethylpyrazol-4-yl)propan-2-ylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110044279 |
| Molecular Formula | C17H32N6O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | N,N-dimethyl-2-[[propylamino-[1-(1,3,5-trimethylpyrazol-4-yl)propan-2-ylamino]methylidene]amino]acetamide |
| SMILES | CCCN/C(=N\CC(=O)N(C)C)NC(C)Cc1c(C)nn(C)c1C |
| InChI | InChI=1S/C17H32N6O/c1-8-9-18-17(19-11-16(24)22(5)6)20-12(2)10-15-13(3)21-23(7)14(15)4/h12H,8-11H2,1-7H3,(H2,18,19,20) |
| InChIKey | RNCCQLDOFKPJJX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|