C19H37IN6O — CID 111365194
2-[[(2-ethylhexylamino)-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111365194) has the molecular formula C19H37IN6O and a molecular weight of 492.45 g/mol. Its IUPAC name is 2-[[(2-ethylhexylamino)-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(2-ethylhexylamino)-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111365194 |
| Molecular Formula | C19H37IN6O |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 2-[[(2-ethylhexylamino)-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCCCC(CC)CN/C(=N\CC(=O)N(C)C)NCCCn1cccn1.I |
| InChI | InChI=1S/C19H36N6O.HI/c1-5-7-10-17(6-2)15-21-19(22-16-18(26)24(3)4)20-11-8-13-25-14-9-12-23-25;/h9,12,14,17H,5-8,10-11,13,15-16H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | DCMXZVIFRKLRGN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|