C19H27ClN6OS — CID 111842810
2-[[[2-(4-chlorophenyl)sulfanylethylamino]-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111842810) has the molecular formula C19H27ClN6OS and a molecular weight of 422.99 g/mol. Its IUPAC name is 2-[[[2-(4-chlorophenyl)sulfanylethylamino]-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[2-(4-chlorophenyl)sulfanylethylamino]-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111842810 |
| Molecular Formula | C19H27ClN6OS |
| Molecular Weight | 422.99 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-[[[2-(4-chlorophenyl)sulfanylethylamino]-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCCn1cccn1)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H27ClN6OS/c1-25(2)18(27)15-23-19(21-9-3-12-26-13-4-10-24-26)22-11-14-28-17-7-5-16(20)6-8-17/h4-8,10,13H,3,9,11-12,14-15H2,1-2H3,(H2,21,22,23) |
| InChIKey | ZCZNELFHYMRFIV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.99 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|