C23H36IN7O — CID 111365778
2-[[[(1-benzylpiperidin-4-yl)amino]-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111365778) has the molecular formula C23H36IN7O and a molecular weight of 553.49 g/mol. Its IUPAC name is 2-[[[(1-benzylpiperidin-4-yl)amino]-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(1-benzylpiperidin-4-yl)amino]-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111365778 |
| Molecular Formula | C23H36IN7O |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | 2-[[[(1-benzylpiperidin-4-yl)amino]-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCCn1cccn1)NC1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C23H35N7O.HI/c1-28(2)22(31)18-25-23(24-12-6-14-30-15-7-13-26-30)27-21-10-16-29(17-11-21)19-20-8-4-3-5-9-20;/h3-5,7-9,13,15,21H,6,10-12,14,16-19H2,1-2H3,(H2,24,25,27);1H |
| InChIKey | LILRNBDNKZFKHJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 77.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|