C23H40IN7O2 — CID 110039282
N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]methylidene]amino]acetamide;hydroiodide (PubChem CID 110039282) has the molecular formula C23H40IN7O2 and a molecular weight of 573.52 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110039282 |
| Molecular Formula | C23H40IN7O2 |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCCN1CCOCC1)NC1CCN(Cc2ccccn2)CC1.I |
| InChI | InChI=1S/C23H39N7O2.HI/c1-28(2)22(31)18-26-23(25-10-5-11-29-14-16-32-17-15-29)27-20-7-12-30(13-8-20)19-21-6-3-4-9-24-21;/h3-4,6,9,20H,5,7-8,10-19H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | XRHUGJAOIDOPPK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|