C20H40N6O2 — CID 111777632
N,N-dimethyl-2-[[[3-(4-methylpiperidin-1-yl)propylamino]-(2-morpholin-4-ylethylamino)methylidene]amino]acetamide (PubChem CID 111777632) has the molecular formula C20H40N6O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[3-(4-methylpiperidin-1-yl)propylamino]-(2-morpholin-4-ylethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[3-(4-methylpiperidin-1-yl)propylamino]-(2-morpholin-4-ylethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111777632 |
| Molecular Formula | C20H40N6O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | N,N-dimethyl-2-[[[3-(4-methylpiperidin-1-yl)propylamino]-(2-morpholin-4-ylethylamino)methylidene]amino]acetamide |
| SMILES | CC1CCN(CCCN/C(=N/CC(=O)N(C)C)NCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C20H40N6O2/c1-18-5-10-25(11-6-18)9-4-7-21-20(23-17-19(27)24(2)3)22-8-12-26-13-15-28-16-14-26/h18H,4-17H2,1-3H3,(H2,21,22,23) |
| InChIKey | GKIXPIPUUGKWGV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|