C18H38IN5O3 — CID 111769876
2-[[(3-butoxypropylamino)-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111769876) has the molecular formula C18H38IN5O3 and a molecular weight of 499.44 g/mol. Its IUPAC name is 2-[[(3-butoxypropylamino)-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(3-butoxypropylamino)-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111769876 |
| Molecular Formula | C18H38IN5O3 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 2-[[(3-butoxypropylamino)-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCCCOCCCN/C(=N\CC(=O)N(C)C)NCCN1CCOCC1.I |
| InChI | InChI=1S/C18H37N5O3.HI/c1-4-5-12-25-13-6-7-19-18(21-16-17(24)22(2)3)20-8-9-23-10-14-26-15-11-23;/h4-16H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | POVYFECEDCDBQE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|