C19H40IN5O2 — CID 111768006
N,N-dimethyl-2-[[(6-methylheptan-2-ylamino)-(2-morpholin-4-ylethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111768006) has the molecular formula C19H40IN5O2 and a molecular weight of 497.47 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(6-methylheptan-2-ylamino)-(2-morpholin-4-ylethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(6-methylheptan-2-ylamino)-(2-morpholin-4-ylethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111768006 |
| Molecular Formula | C19H40IN5O2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | N,N-dimethyl-2-[[(6-methylheptan-2-ylamino)-(2-morpholin-4-ylethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CC(C)CCCC(C)N/C(=N\CC(=O)N(C)C)NCCN1CCOCC1.I |
| InChI | InChI=1S/C19H39N5O2.HI/c1-16(2)7-6-8-17(3)22-19(21-15-18(25)23(4)5)20-9-10-24-11-13-26-14-12-24;/h16-17H,6-15H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | WKGFFKFFOZXSNT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|