C18H37N5O3 — CID 110033827
2-[[[(4-methoxy-2,2-dimethylbutyl)amino]-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110033827) has the molecular formula C18H37N5O3 and a molecular weight of 371.53 g/mol. Its IUPAC name is 2-[[[(4-methoxy-2,2-dimethylbutyl)amino]-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[(4-methoxy-2,2-dimethylbutyl)amino]-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110033827 |
| Molecular Formula | C18H37N5O3 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.29 |
| IUPAC Name | 2-[[[(4-methoxy-2,2-dimethylbutyl)amino]-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COCCC(C)(C)CN/C(=N\CC(=O)N(C)C)NCCN1CCOCC1 |
| InChI | InChI=1S/C18H37N5O3/c1-18(2,6-11-25-5)15-21-17(20-14-16(24)22(3)4)19-7-8-23-9-12-26-13-10-23/h6-15H2,1-5H3,(H2,19,20,21) |
| InChIKey | CHYBXTHUWBWJLY-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|