C22H37N7O2 — CID 110036143
N,N-dimethyl-2-[[(2-morpholin-4-ylethylamino)-[(1-pyridin-4-ylpiperidin-4-yl)methylamino]methylidene]amino]acetamide (PubChem CID 110036143) has the molecular formula C22H37N7O2 and a molecular weight of 431.59 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-morpholin-4-ylethylamino)-[(1-pyridin-4-ylpiperidin-4-yl)methylamino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(2-morpholin-4-ylethylamino)-[(1-pyridin-4-ylpiperidin-4-yl)methylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110036143 |
| Molecular Formula | C22H37N7O2 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | N,N-dimethyl-2-[[(2-morpholin-4-ylethylamino)-[(1-pyridin-4-ylpiperidin-4-yl)methylamino]methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCN1CCOCC1)NCC1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C22H37N7O2/c1-27(2)21(30)18-26-22(24-9-12-28-13-15-31-16-14-28)25-17-19-5-10-29(11-6-19)20-3-7-23-8-4-20/h3-4,7-8,19H,5-6,9-18H2,1-2H3,(H2,24,25,26) |
| InChIKey | QTBKLUHORSEAQC-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|