C20H39N5O2 — CID 110040373
N,N-dimethyl-2-[[(2-morpholin-4-ylethylamino)-[(4-propylcyclohexyl)amino]methylidene]amino]acetamide (PubChem CID 110040373) has the molecular formula C20H39N5O2 and a molecular weight of 381.57 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-morpholin-4-ylethylamino)-[(4-propylcyclohexyl)amino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(2-morpholin-4-ylethylamino)-[(4-propylcyclohexyl)amino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110040373 |
| Molecular Formula | C20H39N5O2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.31 |
| IUPAC Name | N,N-dimethyl-2-[[(2-morpholin-4-ylethylamino)-[(4-propylcyclohexyl)amino]methylidene]amino]acetamide |
| SMILES | CCCC1CCC(N/C(=N/CC(=O)N(C)C)NCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C20H39N5O2/c1-4-5-17-6-8-18(9-7-17)23-20(22-16-19(26)24(2)3)21-10-11-25-12-14-27-15-13-25/h17-18H,4-16H2,1-3H3,(H2,21,22,23) |
| InChIKey | LKPAWLKDGWPANR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|