C17H34IN5O2S — CID 110045830
N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-(thiolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110045830) has the molecular formula C17H34IN5O2S and a molecular weight of 499.46 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-(thiolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-(thiolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110045830 |
| Molecular Formula | C17H34IN5O2S |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-(thiolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(/NCCCN1CCOCC1)NCC1CCCS1.I |
| InChI | InChI=1S/C17H33N5O2S.HI/c1-21(2)16(23)14-20-17(19-13-15-5-3-12-25-15)18-6-4-7-22-8-10-24-11-9-22;/h15H,3-14H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | RHPPFUOICDYKFF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|