C20H34IN5OS — CID 110045846
N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-(thiolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110045846) has the molecular formula C20H34IN5OS and a molecular weight of 519.50 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-(thiolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-(thiolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110045846 |
| Molecular Formula | C20H34IN5OS |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-(thiolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(/NCCCN(C)c1ccccc1)NCC1CCCS1.I |
| InChI | InChI=1S/C20H33N5OS.HI/c1-24(2)19(26)16-23-20(22-15-18-11-7-14-27-18)21-12-8-13-25(3)17-9-5-4-6-10-17;/h4-6,9-10,18H,7-8,11-16H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | KOWIEUXHDPJCTL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|