C23H36N6O2 — CID 111593085
2-[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-[3-(N-methylanilino)propylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111593085) has the molecular formula C23H36N6O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-[3-(N-methylanilino)propylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-[3-(N-methylanilino)propylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111593085 |
| Molecular Formula | C23H36N6O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 2-[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-[3-(N-methylanilino)propylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(/NCCCN(C)c1ccccc1)NCc1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C23H36N6O2/c1-23(2,3)19-15-25-20(31-19)16-26-22(27-17-21(30)28(4)5)24-13-10-14-29(6)18-11-8-7-9-12-18/h7-9,11-12,15H,10,13-14,16-17H2,1-6H3,(H2,24,26,27) |
| InChIKey | RQYTZIKTNYLTIC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|