C24H39IN6O2 — CID 111517395
N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 111517395) has the molecular formula C24H39IN6O2 and a molecular weight of 570.52 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111517395 |
| Molecular Formula | C24H39IN6O2 |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCC(CC)c1cc(CN/C(=N\CC(=O)N(C)C)NCCCN(C)c2ccccc2)on1.I |
| InChI | InChI=1S/C24H38N6O2.HI/c1-6-19(7-2)22-16-21(32-28-22)17-26-24(27-18-23(31)29(3)4)25-14-11-15-30(5)20-12-9-8-10-13-20;/h8-10,12-13,16,19H,6-7,11,14-15,17-18H2,1-5H3,(H2,25,26,27);1H |
| InChIKey | CWFOTVNJAGJEBR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|