C20H32N8O — CID 110034299
N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-[3-(triazol-1-yl)propylamino]methylidene]amino]acetamide (PubChem CID 110034299) has the molecular formula C20H32N8O and a molecular weight of 400.53 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-[3-(triazol-1-yl)propylamino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-[3-(triazol-1-yl)propylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110034299 |
| Molecular Formula | C20H32N8O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-[3-(triazol-1-yl)propylamino]methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(/NCCCN(C)c1ccccc1)NCCCn1ccnn1 |
| InChI | InChI=1S/C20H32N8O/c1-26(2)19(29)17-23-20(22-12-8-15-28-16-13-24-25-28)21-11-7-14-27(3)18-9-5-4-6-10-18/h4-6,9-10,13,16H,7-8,11-12,14-15,17H2,1-3H3,(H2,21,22,23) |
| InChIKey | DUUWUEINXMYRNP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 90.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|