C18H35N7O — CID 110035279
2-[[(2-ethylhexylamino)-[3-(triazol-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110035279) has the molecular formula C18H35N7O and a molecular weight of 365.53 g/mol. Its IUPAC name is 2-[[(2-ethylhexylamino)-[3-(triazol-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(2-ethylhexylamino)-[3-(triazol-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110035279 |
| Molecular Formula | C18H35N7O |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.29 |
| IUPAC Name | 2-[[(2-ethylhexylamino)-[3-(triazol-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCCCC(CC)CN/C(=N\CC(=O)N(C)C)NCCCn1ccnn1 |
| InChI | InChI=1S/C18H35N7O/c1-5-7-9-16(6-2)14-20-18(21-15-17(26)24(3)4)19-10-8-12-25-13-11-22-23-25/h11,13,16H,5-10,12,14-15H2,1-4H3,(H2,19,20,21) |
| InChIKey | UUINAWOKJJPGLW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|