C11H21N5O — CID 107146486
(2S)-2-amino-N-[3-(triazol-1-yl)propyl]hexanamide (PubChem CID 107146486) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-(triazol-1-yl)propyl]hexanamide.
| Compound Name | (2S)-2-amino-N-[3-(triazol-1-yl)propyl]hexanamide |
|---|---|
| PubChem CID | 107146486 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (2S)-2-amino-N-[3-(triazol-1-yl)propyl]hexanamide |
| SMILES | CCCC[C@H](N)C(=O)NCCCn1ccnn1 |
| InChI | InChI=1S/C11H21N5O/c1-2-3-5-10(12)11(17)13-6-4-8-16-9-7-14-15-16/h7,9-10H,2-6,8,12H2,1H3,(H,13,17)/t10-/m0/s1 |
| InChIKey | YNHDHKCKVWJVDH-JTQLQIEISA-N |
| XLogP | 0.30 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|