C10H19N5OS — CID 104909015
(2R)-2-amino-4-methylsulfanyl-N-[3-(triazol-1-yl)propyl]butanamide (PubChem CID 104909015) has the molecular formula C10H19N5OS and a molecular weight of 257.36 g/mol. Its IUPAC name is (2R)-2-amino-4-methylsulfanyl-N-[3-(triazol-1-yl)propyl]butanamide.
| Compound Name | (2R)-2-amino-4-methylsulfanyl-N-[3-(triazol-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 104909015 |
| Molecular Formula | C10H19N5OS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (2R)-2-amino-4-methylsulfanyl-N-[3-(triazol-1-yl)propyl]butanamide |
| SMILES | CSCC[C@@H](N)C(=O)NCCCn1ccnn1 |
| InChI | InChI=1S/C10H19N5OS/c1-17-8-3-9(11)10(16)12-4-2-6-15-7-5-13-14-15/h5,7,9H,2-4,6,8,11H2,1H3,(H,12,16)/t9-/m1/s1 |
| InChIKey | IPQYNOVMPKESND-SECBINFHSA-N |
| XLogP | -0.14 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|