C14H30N2OS — CID 104908132
(2R)-2-amino-N-(7-methyloctyl)-4-methylsulfanylbutanamide (PubChem CID 104908132) has the molecular formula C14H30N2OS and a molecular weight of 274.47 g/mol. Its IUPAC name is (2R)-2-amino-N-(7-methyloctyl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-(7-methyloctyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104908132 |
| Molecular Formula | C14H30N2OS |
| Molecular Weight | 274.47 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | (2R)-2-amino-N-(7-methyloctyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](N)C(=O)NCCCCCCC(C)C |
| InChI | InChI=1S/C14H30N2OS/c1-12(2)8-6-4-5-7-10-16-14(17)13(15)9-11-18-3/h12-13H,4-11,15H2,1-3H3,(H,16,17)/t13-/m1/s1 |
| InChIKey | BOGUAWBWJCYIJN-CYBMUJFWSA-N |
| XLogP | 2.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|