C10H17N5O2S — CID 107769845
2-acetamido-3-sulfanyl-N-[3-(triazol-1-yl)propyl]propanamide (PubChem CID 107769845) has the molecular formula C10H17N5O2S and a molecular weight of 271.35 g/mol. Its IUPAC name is 2-acetamido-3-sulfanyl-N-[3-(triazol-1-yl)propyl]propanamide.
| Compound Name | 2-acetamido-3-sulfanyl-N-[3-(triazol-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 107769845 |
| Molecular Formula | C10H17N5O2S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-acetamido-3-sulfanyl-N-[3-(triazol-1-yl)propyl]propanamide |
| SMILES | CC(=O)NC(CS)C(=O)NCCCn1ccnn1 |
| InChI | InChI=1S/C10H17N5O2S/c1-8(16)13-9(7-18)10(17)11-3-2-5-15-6-4-12-14-15/h4,6,9,18H,2-3,5,7H2,1H3,(H,11,17)(H,13,16) |
| InChIKey | PRIGZKBPNZMQAQ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|