C11H19N5O3 — CID 113413075
(2S)-4-methyl-2-[2-(triazol-1-yl)ethylcarbamoylamino]pentanoic acid (PubChem CID 113413075) has the molecular formula C11H19N5O3 and a molecular weight of 269.30 g/mol. Its IUPAC name is (2S)-4-methyl-2-[2-(triazol-1-yl)ethylcarbamoylamino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[2-(triazol-1-yl)ethylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 113413075 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | (2S)-4-methyl-2-[2-(triazol-1-yl)ethylcarbamoylamino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)NCCn1ccnn1)C(=O)O |
| InChI | InChI=1S/C11H19N5O3/c1-8(2)7-9(10(17)18)14-11(19)12-3-5-16-6-4-13-15-16/h4,6,8-9H,3,5,7H2,1-2H3,(H,17,18)(H2,12,14,19)/t9-/m0/s1 |
| InChIKey | DOTMRHMMJUQLID-VIFPVBQESA-N |
| XLogP | 0.08 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |