C9H15N5O4 — CID 107828886
(2R)-4-hydroxy-2-[2-(triazol-1-yl)ethylcarbamoylamino]butanoic acid (PubChem CID 107828886) has the molecular formula C9H15N5O4 and a molecular weight of 257.25 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-[2-(triazol-1-yl)ethylcarbamoylamino]butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-[2-(triazol-1-yl)ethylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 107828886 |
| Molecular Formula | C9H15N5O4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (2R)-4-hydroxy-2-[2-(triazol-1-yl)ethylcarbamoylamino]butanoic acid |
| SMILES | O=C(NCCn1ccnn1)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C9H15N5O4/c15-6-1-7(8(16)17)12-9(18)10-2-4-14-5-3-11-13-14/h3,5,7,15H,1-2,4,6H2,(H,16,17)(H2,10,12,18)/t7-/m1/s1 |
| InChIKey | MAWAQXBFQGDNKR-SSDOTTSWSA-N |
| XLogP | -1.59 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |