C12H21N5O3 — CID 107146507
(2S)-2-[3-(triazol-1-yl)propylcarbamoylamino]hexanoic acid (PubChem CID 107146507) has the molecular formula C12H21N5O3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (2S)-2-[3-(triazol-1-yl)propylcarbamoylamino]hexanoic acid.
| Compound Name | (2S)-2-[3-(triazol-1-yl)propylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 107146507 |
| Molecular Formula | C12H21N5O3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2S)-2-[3-(triazol-1-yl)propylcarbamoylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)NCCCn1ccnn1)C(=O)O |
| InChI | InChI=1S/C12H21N5O3/c1-2-3-5-10(11(18)19)15-12(20)13-6-4-8-17-9-7-14-16-17/h7,9-10H,2-6,8H2,1H3,(H,18,19)(H2,13,15,20)/t10-/m0/s1 |
| InChIKey | FOIFXMOEVZKTTC-JTQLQIEISA-N |
| XLogP | 0.61 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|