C11H18N4O4 — CID 114005816
(2S)-4-hydroxy-2-(3-pyrazol-1-ylpropylcarbamoylamino)butanoic acid (PubChem CID 114005816) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-(3-pyrazol-1-ylpropylcarbamoylamino)butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-(3-pyrazol-1-ylpropylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 114005816 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (2S)-4-hydroxy-2-(3-pyrazol-1-ylpropylcarbamoylamino)butanoic acid |
| SMILES | O=C(NCCCn1cccn1)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C11H18N4O4/c16-8-3-9(10(17)18)14-11(19)12-4-1-6-15-7-2-5-13-15/h2,5,7,9,16H,1,3-4,6,8H2,(H,17,18)(H2,12,14,19)/t9-/m0/s1 |
| InChIKey | ZZSVWMPAJQCQSW-VIFPVBQESA-N |
| XLogP | -0.59 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|