C12H20N4O — CID 47221371
1-(1-cyclopropylethyl)-3-(3-pyrazol-1-ylpropyl)urea (PubChem CID 47221371) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 1-(1-cyclopropylethyl)-3-(3-pyrazol-1-ylpropyl)urea.
| Compound Name | 1-(1-cyclopropylethyl)-3-(3-pyrazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 47221371 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1-(1-cyclopropylethyl)-3-(3-pyrazol-1-ylpropyl)urea |
| SMILES | CC(NC(=O)NCCCn1cccn1)C1CC1 |
| InChI | InChI=1S/C12H20N4O/c1-10(11-4-5-11)15-12(17)13-6-2-8-16-9-3-7-14-16/h3,7,9-11H,2,4-6,8H2,1H3,(H2,13,15,17) |
| InChIKey | PXJSNENFEUOUKM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|