C7H15N3O6S — CID 107826259
(2S)-4-hydroxy-2-(2-sulfamoylethylcarbamoylamino)butanoic acid (PubChem CID 107826259) has the molecular formula C7H15N3O6S and a molecular weight of 269.28 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-(2-sulfamoylethylcarbamoylamino)butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-(2-sulfamoylethylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 107826259 |
| Molecular Formula | C7H15N3O6S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (2S)-4-hydroxy-2-(2-sulfamoylethylcarbamoylamino)butanoic acid |
| SMILES | NS(=O)(=O)CCNC(=O)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C7H15N3O6S/c8-17(15,16)4-2-9-7(14)10-5(1-3-11)6(12)13/h5,11H,1-4H2,(H,12,13)(H2,8,15,16)(H2,9,10,14)/t5-/m0/s1 |
| InChIKey | CEWYTSBVOZDOFB-YFKPBYRVSA-N |
| XLogP | -2.59 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |