C7H13N3O5 — CID 107825557
(2S)-2-[(2-amino-2-oxoethyl)carbamoylamino]-4-hydroxybutanoic acid (PubChem CID 107825557) has the molecular formula C7H13N3O5 and a molecular weight of 219.20 g/mol. Its IUPAC name is (2S)-2-[(2-amino-2-oxoethyl)carbamoylamino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[(2-amino-2-oxoethyl)carbamoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107825557 |
| Molecular Formula | C7H13N3O5 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (2S)-2-[(2-amino-2-oxoethyl)carbamoylamino]-4-hydroxybutanoic acid |
| SMILES | NC(=O)CNC(=O)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C7H13N3O5/c8-5(12)3-9-7(15)10-4(1-2-11)6(13)14/h4,11H,1-3H2,(H2,8,12)(H,13,14)(H2,9,10,15)/t4-/m0/s1 |
| InChIKey | YMTJETMVDBCZJT-BYPYZUCNSA-N |
| XLogP | -2.39 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |