C6H12N2O4 — CID 91507162
(2R)-4-hydroxy-2-(methylcarbamoylamino)butanoic acid (PubChem CID 91507162) has the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-(methylcarbamoylamino)butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-(methylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 91507162 |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (2R)-4-hydroxy-2-(methylcarbamoylamino)butanoic acid |
| SMILES | CNC(=O)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C6H12N2O4/c1-7-6(12)8-4(2-3-9)5(10)11/h4,9H,2-3H2,1H3,(H,10,11)(H2,7,8,12)/t4-/m1/s1 |
| InChIKey | LOSSYWPGWBVWFP-SCSAIBSYSA-N |
| XLogP | -1.25 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |