C8H13N3O6 — CID 63307403
(2S)-2-[(2-amino-2-oxoethyl)carbamoylamino]-4-methoxy-4-oxobutanoic acid (PubChem CID 63307403) has the molecular formula C8H13N3O6 and a molecular weight of 247.21 g/mol. Its IUPAC name is (2S)-2-[(2-amino-2-oxoethyl)carbamoylamino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[(2-amino-2-oxoethyl)carbamoylamino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63307403 |
| Molecular Formula | C8H13N3O6 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (2S)-2-[(2-amino-2-oxoethyl)carbamoylamino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NC(=O)NCC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H13N3O6/c1-17-6(13)2-4(7(14)15)11-8(16)10-3-5(9)12/h4H,2-3H2,1H3,(H2,9,12)(H,14,15)(H2,10,11,16)/t4-/m0/s1 |
| InChIKey | CLSODYVSMYDULC-BYPYZUCNSA-N |
| XLogP | -2.21 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |