C6H11N3O4 — CID 30111500
(2S)-2-[(2-amino-2-oxoethyl)carbamoylamino]propanoic acid (PubChem CID 30111500) has the molecular formula C6H11N3O4 and a molecular weight of 189.17 g/mol. Its IUPAC name is (2S)-2-[(2-amino-2-oxoethyl)carbamoylamino]propanoic acid.
| Compound Name | (2S)-2-[(2-amino-2-oxoethyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 30111500 |
| Molecular Formula | C6H11N3O4 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | (2S)-2-[(2-amino-2-oxoethyl)carbamoylamino]propanoic acid |
| SMILES | C[C@H](NC(=O)NCC(N)=O)C(=O)O |
| InChI | InChI=1S/C6H11N3O4/c1-3(5(11)12)9-6(13)8-2-4(7)10/h3H,2H2,1H3,(H2,7,10)(H,11,12)(H2,8,9,13)/t3-/m0/s1 |
| InChIKey | YKQDRQRYGPNQOT-VKHMYHEASA-N |
| XLogP | -1.76 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |