C10H16N4O5S — CID 43107767
4-methylsulfonyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid (PubChem CID 43107767) has the molecular formula C10H16N4O5S and a molecular weight of 304.33 g/mol. Its IUPAC name is 4-methylsulfonyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid.
| Compound Name | 4-methylsulfonyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 43107767 |
| Molecular Formula | C10H16N4O5S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-methylsulfonyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid |
| SMILES | CS(=O)(=O)CCC(NC(=O)CCn1ccnn1)C(=O)O |
| InChI | InChI=1S/C10H16N4O5S/c1-20(18,19)7-3-8(10(16)17)12-9(15)2-5-14-6-4-11-13-14/h4,6,8H,2-3,5,7H2,1H3,(H,12,15)(H,16,17) |
| InChIKey | CLOBSQLBQBEZCX-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |