C9H12N4O — CID 114389728
N-but-3-yn-2-yl-3-(triazol-1-yl)propanamide (PubChem CID 114389728) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is N-but-3-yn-2-yl-3-(triazol-1-yl)propanamide.
| Compound Name | N-but-3-yn-2-yl-3-(triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 114389728 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | N-but-3-yn-2-yl-3-(triazol-1-yl)propanamide |
| SMILES | C#CC(C)NC(=O)CCn1ccnn1 |
| InChI | InChI=1S/C9H12N4O/c1-3-8(2)11-9(14)4-6-13-7-5-10-12-13/h1,5,7-8H,4,6H2,2H3,(H,11,14) |
| InChIKey | LEEISHYCEBDZHY-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|